CAS 39178-60-4 appears in our catalog under these names: 5-Bromo-2-ethylbenzofuran, 95%, 5–Bromo–2–ethylbenzofuran. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-2-ethyl-1-benzofuran (CAS 39178-60-4) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 5-bromo-2-ethyl-1-benzofuran. InChIKey: IXCGZKOZXSKKFI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 5-bromo-2-ethyl-1-benzofuran |
| InChIKey | IXCGZKOZXSKKFI-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)