CAS 391927-10-9 appears in our catalog under these names: 2-(Oxazol-4-yl)phenol, 97%, 2-(Oxazol-4-yl)phenol, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
2-(1,3-oxazol-4-yl)phenol (CAS 391927-10-9) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-(1,3-oxazol-4-yl)phenol. InChIKey: JWISGKXKSCBIJQ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(1,3-oxazol-4-yl)phenol |
| InChIKey | JWISGKXKSCBIJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=COC=N2)O |
Computed by PubChem (NCBI)