CAS 39226-88-5 is the registry number for 6-Methoxy-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)azanium chloride (CAS 39226-88-5) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)azanium chloride. InChIKey: DGIFWWPVOFOTLY-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)azanium chloride |
| InChIKey | DGIFWWPVOFOTLY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(CCC2)[NH3+].[Cl-] |
Computed by PubChem (NCBI)