CAS 392319-07-2 is the registry number for 5-Bromo-4-chloro-2-nitrobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-4-chloro-2-nitrobenzoic acid (CAS 392319-07-2) is a chemical compound with the molecular formula C7H3BrClNO4 and a molecular weight of 280.46 g/mol. IUPAC name: 5-bromo-4-chloro-2-nitrobenzoic acid. InChIKey: MGTZFKZXVQJILX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO4 |
|---|---|
| Molecular weight | 280.46 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-nitrobenzoic acid |
| InChIKey | MGTZFKZXVQJILX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)