CAS 60541-88-0 appears in our catalog under these names: 5-Bromo-2-chloro-3-nitrobenzoic acid, 5-Bromo-2-chloro-3-nitrobenzoic acid 95%, 5-Bromo-2-chloro-3-nitrobenzoic acid, 95%, 95%, 5-Bromo-2-chloro-3-nitrobenzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g.
5-bromo-2-chloro-3-nitrobenzoic acid (CAS 60541-88-0) is a chemical compound with the molecular formula C7H3BrClNO4 and a molecular weight of 280.46 g/mol. IUPAC name: 5-bromo-2-chloro-3-nitrobenzoic acid. InChIKey: BLINULPTLDKOLO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO4 |
|---|---|
| Molecular weight | 280.46 g/mol |
| IUPAC name | 5-bromo-2-chloro-3-nitrobenzoic acid |
| InChIKey | BLINULPTLDKOLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)