CAS 39232-85-4 appears in our catalog under these names: 7-Methyl Tryptophol, 7-Methyltryptophol, 2-(7-Methyl-1H-indol-3-yl)ethanol, 95+%. Offered by: Chemat Brand, TRC, AmBeed. Available pack sizes: on request, 500mg, 5g, 1g.
2-(7-methyl-1H-indol-3-yl)ethanol (CAS 39232-85-4) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2-(7-methyl-1H-indol-3-yl)ethanol. InChIKey: KGZBKPDQVCRMSP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-(7-methyl-1H-indol-3-yl)ethanol |
| InChIKey | KGZBKPDQVCRMSP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)CCO |
Computed by PubChem (NCBI)