CAS 39244-78-5 is the registry number for 11-(3-Bromopropylidene)-6,11-dihydrodibenzo(b,e)oxepine. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
(11E)-11-(3-bromopropylidene)-6H-benzo[c][1]benzoxepine (CAS 39244-78-5) is a chemical compound with the molecular formula C17H15BrO and a molecular weight of 315.2 g/mol. IUPAC name: (11E)-11-(3-bromopropylidene)-6H-benzo[c][1]benzoxepine. InChIKey: DETQAGMEETUWKX-OQLLNIDSSA-N.
| Molecular formula | C17H15BrO |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | (11E)-11-(3-bromopropylidene)-6H-benzo[c][1]benzoxepine |
| InChIKey | DETQAGMEETUWKX-OQLLNIDSSA-N |
| SMILES | C1C2=CC=CC=C2/C(=C\CCBr)/C3=CC=CC=C3O1 |
Computed by PubChem (NCBI)