CAS 98216-27-4 is the registry number for 2-Bromo-1-(9,9-dimethyl-fluoren-2-yl)ethanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-bromo-1-(9,9-dimethylfluoren-2-yl)ethanone (CAS 98216-27-4) is a chemical compound with the molecular formula C17H15BrO and a molecular weight of 315.2 g/mol. IUPAC name: 2-bromo-1-(9,9-dimethylfluoren-2-yl)ethanone. InChIKey: NVCPBAUAQRVSRX-UHFFFAOYSA-N.
| Molecular formula | C17H15BrO |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 2-bromo-1-(9,9-dimethylfluoren-2-yl)ethanone |
| InChIKey | NVCPBAUAQRVSRX-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)CBr)C |
Computed by PubChem (NCBI)