CAS 393183-92-1 appears in our catalog under these names: 4-(5-Fluoroindolin-1-yl)-4-oxobutanoic acid, 95+%, 4-(5-Fluoro-2,3-dihydro-1H-indol-1-yl)-4-oxobutanoic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxobutanoic acid (CAS 393183-92-1) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxobutanoic acid. InChIKey: ZDCJLZIXLLVVRJ-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO3 |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxobutanoic acid |
| InChIKey | ZDCJLZIXLLVVRJ-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)F)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)