Products 393522-78-6
CAS 393522-78-6 appears in our catalog under these names: Methyl 4-[4-(hydroxymethyl)phenyl]benzoate, 95%, Methyl 4'–(hydroxymethyl)–(1，1'–biphenyl)–4–carboxylate, Methyl 4'-(hydroxymethyl)-[1,1'-biphenyl]-4-carboxylate, 97%(GC-MS),RG, 97%(GC-MS),RG, Methyl 4'-(hydroxymethyl)-[1,1'-biphenyl]-4-carboxylate. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
Methyl 4-[4-(hydroxymethyl)phenyl]benzoate (CAS 393522-78-6) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 4-[4-(hydroxymethyl)phenyl]benzoate. InChIKey: VKZMIOMZIBDFLC-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 4-[4-(hydroxymethyl)phenyl]benzoate |
| InChIKey | VKZMIOMZIBDFLC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)