Products 3943-91-7
CAS 3943-91-7 appears in our catalog under these names: Ethyl 2,5-dihydroxybenzoate, 97%, ethyl 2,5-Dihydroxybenzoate, ethyl 2,5–Dihydroxybenzoate, Ethyl 2,5-Dihydroxybenzoate, >98.0%(GC), Ethyl gentisate 98%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 250mg, 5g, 500mg, 100mg, 1 g, 500 mg, 10mM/1mL.
Ethyl 2,5-dihydroxybenzoate (CAS 3943-91-7) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: ethyl 2,5-dihydroxybenzoate. InChIKey: GCUPAENRSCPHBM-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | ethyl 2,5-dihydroxybenzoate |
| InChIKey | GCUPAENRSCPHBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)O)O |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2,5-dihydroxybenzoate, ethyl gentisate, Benzoic acid, 2,5-dihydroxy-, ethyl ester, 2,5-dihydroxybenzoic acid ethyl ester, Ethylgentisate, ethyl 25-Dihydroxybenzoate, Ethyl2,5-dihydroxybenzoate, Gentisic acid, ethyl ester, mono ethoxycarbonyl hydroquinone, Ethyl 2,5-dihydroxybenzoate #