CAS 394729-98-7 appears in our catalog under these names: 2-chloro-4-methoxynicotinic acid, 98%, 98%, 2-Chloro-4-methoxynicotinic acid 98%, 2-Chloro-4-methoxynicotinic acid, 98%, 2–Chloro–4–methoxynicotinic acid. Offered by: Chemat, Ambeed, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-chloro-4-methoxypyridine-3-carboxylic acid (CAS 394729-98-7) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 2-chloro-4-methoxypyridine-3-carboxylic acid. InChIKey: ZBHVWHBZHRBHRQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-chloro-4-methoxypyridine-3-carboxylic acid |
| InChIKey | ZBHVWHBZHRBHRQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)