CAS 39478-62-1 is the registry number for (S)-Apomorphine. Offered by: Chemat Brand. Available pack sizes: on request.
(6aS)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol (CAS 39478-62-1) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: (6aS)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol. InChIKey: VMWNQDUVQKEIOC-ZDUSSCGKSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | (6aS)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
| InChIKey | VMWNQDUVQKEIOC-ZDUSSCGKSA-N |
| SMILES | CN1CCC2=C3[C@@H]1CC4=C(C3=CC=C2)C(=C(C=C4)O)O |
Computed by PubChem (NCBI)