Products 395-15-3
CAS 395-15-3 is the registry number for 3-Bromo-1,1,1-trifluoro-3-phenylpropan-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-1,1,1-trifluoro-3-phenylpropan-2-one (CAS 395-15-3) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 3-bromo-1,1,1-trifluoro-3-phenylpropan-2-one. InChIKey: XWQPKCABAXIHPC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 3-bromo-1,1,1-trifluoro-3-phenylpropan-2-one |
| InChIKey | XWQPKCABAXIHPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)