CAS 39520-25-7 is the registry number for Dimethyl 2-(tert-butyl)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 2-tert-butylpropanedioate (CAS 39520-25-7) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: dimethyl 2-tert-butylpropanedioate. InChIKey: OBANUQSDPDUGSL-UHFFFAOYSA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | dimethyl 2-tert-butylpropanedioate |
| InChIKey | OBANUQSDPDUGSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)