CAS 39539-69-0 is the registry number for 6-Phenoxypyridazin-3-amine. Offered by: TRC. Available pack sizes: 50mg.
6-phenoxypyridazin-3-amine (CAS 39539-69-0) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 6-phenoxypyridazin-3-amine. InChIKey: IGTXIZACJFSMLX-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 6-phenoxypyridazin-3-amine |
| InChIKey | IGTXIZACJFSMLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NN=C(C=C2)N |
Computed by PubChem (NCBI)