CAS 3954-26-5 appears in our catalog under these names: 3,4-Diaminothieno[2,3-b]thiophene-2,5-dicarbonitrile, 95%, 95%, 3,4-Diaminothieno[2,3-b]thiophene-2,5-dicarbonitrile, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
3,4-diaminothieno[2,3-b]thiophene-2,5-dicarbonitrile (CAS 3954-26-5) is a chemical compound with the molecular formula C8H4N4S2 and a molecular weight of 220.3 g/mol. IUPAC name: 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarbonitrile. InChIKey: KZBSENMHTIDEHV-UHFFFAOYSA-N.
| Molecular formula | C8H4N4S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarbonitrile |
| InChIKey | KZBSENMHTIDEHV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C2=C(S1)SC(=C2N)C#N)N |
Computed by PubChem (NCBI)