CAS 875312-72-4 is the registry number for 1-Phenyl-4-(4-(trifluoromethyl)phenyl)-1H-1,2,3-triazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-phenyl-4-[4-(trifluoromethyl)phenyl]triazole (CAS 875312-72-4) is a chemical compound with the molecular formula C15H10F3N3 and a molecular weight of 289.25 g/mol. IUPAC name: 1-phenyl-4-[4-(trifluoromethyl)phenyl]triazole. InChIKey: FCBOEYGODVCJLJ-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | 1-phenyl-4-[4-(trifluoromethyl)phenyl]triazole |
| InChIKey | FCBOEYGODVCJLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)