CAS 39616-99-4 appears in our catalog under these names: 1–(4–fluoro–2–nitrophenyl)propan–2–one, 1-(4-fluoro-2-nitrophenyl)propan-2-one, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 200mg, 1g, 10g, 100mg, 5g, 250mg.
1-(4-fluoro-2-nitrophenyl)propan-2-one (CAS 39616-99-4) is a chemical compound with the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. IUPAC name: 1-(4-fluoro-2-nitrophenyl)propan-2-one. InChIKey: ZUSSYVUYWCVGHV-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO3 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 1-(4-fluoro-2-nitrophenyl)propan-2-one |
| InChIKey | ZUSSYVUYWCVGHV-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)