CAS 397283-49-7 is the registry number for 4-(4-Bromophenyl)-2,5-dimethylthiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-(4-bromophenyl)-2,5-dimethyl-1,3-thiazole (CAS 397283-49-7) is a chemical compound with the molecular formula C11H10BrNS and a molecular weight of 268.17 g/mol. IUPAC name: 4-(4-bromophenyl)-2,5-dimethyl-1,3-thiazole. InChIKey: JSTYHWXLJQUUID-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNS |
|---|---|
| Molecular weight | 268.17 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2,5-dimethyl-1,3-thiazole |
| InChIKey | JSTYHWXLJQUUID-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)