CAS 852180-42-8 is the registry number for 4-(3-(Bromomethyl)phenyl)-2-methylthiazole hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-(bromomethyl)phenyl]-2-methyl-1,3-thiazole (CAS 852180-42-8) is a chemical compound with the molecular formula C11H10BrNS and a molecular weight of 268.17 g/mol. IUPAC name: 4-[3-(bromomethyl)phenyl]-2-methyl-1,3-thiazole. InChIKey: XIUGTLOVQIQYNJ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNS |
|---|---|
| Molecular weight | 268.17 g/mol |
| IUPAC name | 4-[3-(bromomethyl)phenyl]-2-methyl-1,3-thiazole |
| InChIKey | XIUGTLOVQIQYNJ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=CC(=C2)CBr |
Computed by PubChem (NCBI)