CAS 39731-47-0 is the registry number for 1,3,6-Trihydroxy-9H-xanthen-9-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,6-trihydroxyxanthen-9-one (CAS 39731-47-0) is a chemical compound with the molecular formula C13H8O5 and a molecular weight of 244.20 g/mol. IUPAC name: 1,3,6-trihydroxyxanthen-9-one. InChIKey: WRIILVBYWBDSMT-UHFFFAOYSA-N.
| Molecular formula | C13H8O5 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 1,3,6-trihydroxyxanthen-9-one |
| InChIKey | WRIILVBYWBDSMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC3=CC(=CC(=C3C2=O)O)O |
Computed by PubChem (NCBI)