CAS 531512-26-2 appears in our catalog under these names: Urolithin M7, Urolithin M7, >95% (HPLC), Urolithin M7, 95.63%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 20mg, 2.5 mg, 10 mg, 25 mg.
3,8,10-trihydroxybenzo[c]chromen-6-one (CAS 531512-26-2) is a chemical compound with the molecular formula C13H8O5 and a molecular weight of 244.20 g/mol. IUPAC name: 3,8,10-trihydroxybenzo[c]chromen-6-one. InChIKey: AKJHSPSPAOUDFT-UHFFFAOYSA-N.
| Molecular formula | C13H8O5 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 3,8,10-trihydroxybenzo[c]chromen-6-one |
| InChIKey | AKJHSPSPAOUDFT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C3=C2C(=CC(=C3)O)O |
Computed by PubChem (NCBI)