CAS 39746-01-5 appears in our catalog under these names: Corey Lactone Aldehyde Benzoate, Travoprost Impurity 16, 3beta-Benzoyloxy-2beta-carboxaldehyde-5alpha-hydroxy-1alpha-cyclopentaneacetic Acid gamma-Lactone, Corey lactone aldehyde benzoate. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 5g, on request, 2,5g, 1g, 500mg, Get quote.
[(3aR,4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (CAS 39746-01-5) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: [(3aR,4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate. InChIKey: NDHMOBCVFGMXRK-FVCCEPFGSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | [(3aR,4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| InChIKey | NDHMOBCVFGMXRK-FVCCEPFGSA-N |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@H]([C@@H]1OC(=O)C3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)