CAS 39746-23-1 appears in our catalog under these names: 16,16–dimethyl Prostaglandin F2α, 16,16-dimethyl Prostaglandin F2α, 16,16-Dimethylprostaglandin F2α. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 5 mg, 1 mg.
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoic acid (CAS 39746-23-1) is a chemical compound with the molecular formula C22H38O5 and a molecular weight of 382.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoic acid. InChIKey: YMRWVEHSLXJOCD-SCOYTADVSA-N.
| Molecular formula | C22H38O5 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoic acid |
| InChIKey | YMRWVEHSLXJOCD-SCOYTADVSA-N |
| SMILES | CCCCC(C)(C)[C@@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C\CCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)