Products 39757-34-1
CAS 39757-34-1 is the registry number for Methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
Methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate (CAS 39757-34-1) is a chemical compound with the molecular formula C11H9FO4 and a molecular weight of 224.18 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate. InChIKey: PAEDUWHKVNTJMJ-UHFFFAOYSA-N.
| Molecular formula | C11H9FO4 |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate |
| InChIKey | PAEDUWHKVNTJMJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-(4-fluorophenyl)-2,4-dioxobutanoate, Methyl 4-(4-fluorophenyl)-2,4-dioxo-butanoate, Methyl 4-fluoro-a,g-dioxo-benzenebutanoate, methyl 4-(4-fluorophenyl]-2,4-diketobutanoate, methyl 4-[4-fluorophenyl]-2,4-diketobutanoate, 4-(4-Fluoro-phenyl)-2,4-dioxo-butyric acid methyl ester, PAEDUWHKVNTJMJ-UHFFFAOYSA-N, 4-fluoro benzoyl pyruvate methylester, methyl 4-[4-fluorophenyl]2,4-diketobutanoate, 4-(4-Fluorophenyl)-2,4-dioxo-butyric acid methyl ester