CAS 773132-38-0 appears in our catalog under these names: 3-(6-Fluoro-2,4-dihydro-1,3-benzodioxin-8-yl)prop-2-enoic acid, 95%, (2E)-3-(6-Fluoro-2,4-dihydro-1,3-benzodioxin-8-yl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(E)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)prop-2-enoic acid (CAS 773132-38-0) is a chemical compound with the molecular formula C11H9FO4 and a molecular weight of 224.18 g/mol. IUPAC name: (E)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)prop-2-enoic acid. InChIKey: RIBPFILKLFAJKT-OWOJBTEDSA-N.
| Molecular formula | C11H9FO4 |
|---|---|
| Molecular weight | 224.18 g/mol |
| IUPAC name | (E)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)prop-2-enoic acid |
| InChIKey | RIBPFILKLFAJKT-OWOJBTEDSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)/C=C/C(=O)O)OCO1 |
Computed by PubChem (NCBI)