CAS 397878-17-0 appears in our catalog under these names: Deaminase inhibitor–1, 5-(3-Bromo-4-methoxybenzyl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, 97%, 97%, Deaminase inhibitor-1, 99.64%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 50 mg, 5 mg.
3-[(3-bromo-4-methoxyphenyl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione (CAS 397878-17-0) is a chemical compound with the molecular formula C11H12BrN3OS and a molecular weight of 314.20 g/mol. IUPAC name: 3-[(3-bromo-4-methoxyphenyl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: JFEBTANALIHFDD-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3OS |
|---|---|
| Molecular weight | 314.20 g/mol |
| IUPAC name | 3-[(3-bromo-4-methoxyphenyl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | JFEBTANALIHFDD-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)CC2=CC(=C(C=C2)OC)Br |
Computed by PubChem (NCBI)