Products 923828-89-1
CAS 923828-89-1 is the registry number for 4-Bromo-N-(4,5-dimethylthiazol-2-yl)-1-methyl-1H-pyrrole-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-methylpyrrole-2-carboxamide (CAS 923828-89-1) is a chemical compound with the molecular formula C11H12BrN3OS and a molecular weight of 314.20 g/mol. IUPAC name: 4-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-methylpyrrole-2-carboxamide. InChIKey: QNFNXTXGJLEIGU-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3OS |
|---|---|
| Molecular weight | 314.20 g/mol |
| IUPAC name | 4-bromo-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1-methylpyrrole-2-carboxamide |
| InChIKey | QNFNXTXGJLEIGU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C2=CC(=CN2C)Br)C |
Computed by PubChem (NCBI)