CAS 39938-79-9 appears in our catalog under these names: 1-(3-Aminophenyl)-3,3-dimethylurea, 95%, 1-(3-Aminophenyl)-3,3-dimethylurea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(3-aminophenyl)-1,1-dimethylurea (CAS 39938-79-9) is a chemical compound with the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. IUPAC name: 3-(3-aminophenyl)-1,1-dimethylurea. InChIKey: MZCIMHCGCFGWJS-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 3-(3-aminophenyl)-1,1-dimethylurea |
| InChIKey | MZCIMHCGCFGWJS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=CC(=C1)N |
Computed by PubChem (NCBI)