Products 39942-49-9
CAS 39942-49-9 appears in our catalog under these names: 3-Nitro Lidocaine, >95% (HPLC), 3-Nitro lidocaine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 0,01g, 0,025g, 0,05g.
2-(diethylamino)-N-(2,6-dimethyl-3-nitrophenyl)acetamide (CAS 39942-49-9) is a chemical compound with the molecular formula C14H21N3O3 and a molecular weight of 279.33 g/mol. IUPAC name: 2-(diethylamino)-N-(2,6-dimethyl-3-nitrophenyl)acetamide. InChIKey: BLYIETDHPXAQHR-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O3 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 2-(diethylamino)-N-(2,6-dimethyl-3-nitrophenyl)acetamide |
| InChIKey | BLYIETDHPXAQHR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC(=C1C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)