Products 3997-89-5
CAS 3997-89-5 appears in our catalog under these names: Cyclopentanone-2,2,5,5-d4, 95%, Cyclopentanone-2,2,5,5-d4, 98 atom % D, min 98% Chemical Purity, Cyclopentanone-2,2,5,5-d{4}, 95% . Offered by: Combi-blocks, CDN, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 0,5g.
2,2,5,5-tetradeuteriocyclopentan-1-one (CAS 3997-89-5) is a chemical compound with the molecular formula C5H8O and a molecular weight of 88.14 g/mol. IUPAC name: 2,2,5,5-tetradeuteriocyclopentan-1-one. InChIKey: BGTOWKSIORTVQH-KHORGVISSA-N.
| Molecular formula | C5H8O |
|---|---|
| Molecular weight | 88.14 g/mol |
| IUPAC name | 2,2,5,5-tetradeuteriocyclopentan-1-one |
| InChIKey | BGTOWKSIORTVQH-KHORGVISSA-N |
| SMILES | [2H]C1(CCC(C1=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)