Products 4477-17-2
CAS 4477-17-2 appears in our catalog under these names: Cyclopentanone-d8, 98 atom % D, min 98% Chemical Purity, Cyclopentanone–d8(7CI，8CI，9CI). Offered by: CDN, GLPBio. Available pack sizes: 0,5g, 0,25g, 10mg.
2,2,3,3,4,4,5,5-octadeuteriocyclopentan-1-one (CAS 4477-17-2) is a chemical compound with the molecular formula C5H8O and a molecular weight of 92.17 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octadeuteriocyclopentan-1-one. InChIKey: BGTOWKSIORTVQH-SVYQBANQSA-N.
| Molecular formula | C5H8O |
|---|---|
| Molecular weight | 92.17 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octadeuteriocyclopentan-1-one |
| InChIKey | BGTOWKSIORTVQH-SVYQBANQSA-N |
| SMILES | [2H]C1(C(=O)C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)