Products 40027-72-3
CAS 40027-72-3 is the registry number for Bromamphenicol. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
2,2-dibromo-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide (CAS 40027-72-3) is a chemical compound with the molecular formula C11H12Br2N2O5 and a molecular weight of 412.03 g/mol. IUPAC name: 2,2-dibromo-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide. InChIKey: UWOHGNMWBGIRAQ-RKDXNWHRSA-N.
| Molecular formula | C11H12Br2N2O5 |
|---|---|
| Molecular weight | 412.03 g/mol |
| IUPAC name | 2,2-dibromo-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | UWOHGNMWBGIRAQ-RKDXNWHRSA-N |
| SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Br)Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)