CAS 61135-36-2 is the registry number for Brivudine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,2-dibromoethenyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 61135-36-2) is a chemical compound with the molecular formula C11H12Br2N2O5 and a molecular weight of 412.03 g/mol. IUPAC name: 5-(2,2-dibromoethenyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: OGFRDDQDVKGOPG-LKEWCRSYSA-N.
| Molecular formula | C11H12Br2N2O5 |
|---|---|
| Molecular weight | 412.03 g/mol |
| IUPAC name | 5-(2,2-dibromoethenyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | OGFRDDQDVKGOPG-LKEWCRSYSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)C=C(Br)Br)CO)O |
Computed by PubChem (NCBI)