CAS 4003-88-7 appears in our catalog under these names: 6-Methoxy-1,2,3,4-tetrahydro-naphthalen-2-ylamine Hydrochloride, 6-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride, 95%+, 95%+. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
6-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (CAS 4003-88-7) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 6-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride. InChIKey: VANKCRQVOCWUPP-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 6-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| InChIKey | VANKCRQVOCWUPP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(CC2)N)C=C1.Cl |
Computed by PubChem (NCBI)