Products 4004-20-0

CAS 4004-20-0 is the registry number for Diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate (CAS 4004-20-0) is a chemical compound with the molecular formula C12H14N2O4S2 and a molecular weight of 314.4 g/mol. IUPAC name: diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate. InChIKey: FTGFURZVTLYXEX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O4S2
Molecular weight314.4 g/mol
IUPAC namediethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate
InChIKeyFTGFURZVTLYXEX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=C(S1)SC(=C2N)C(=O)OCC)N

Computed by PubChem (NCBI)