CAS 4004-20-0 is the registry number for Diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate (CAS 4004-20-0) is a chemical compound with the molecular formula C12H14N2O4S2 and a molecular weight of 314.4 g/mol. IUPAC name: diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate. InChIKey: FTGFURZVTLYXEX-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | diethyl 3,4-diaminothieno[2,3-b]thiophene-2,5-dicarboxylate |
| InChIKey | FTGFURZVTLYXEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)SC(=C2N)C(=O)OCC)N |
Computed by PubChem (NCBI)