CAS 86394-94-7 is the registry number for L-645151. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-sulfamoyl-1,3-benzothiazol-6-yl) 2,2-dimethylpropanoate (CAS 86394-94-7) is a chemical compound with the molecular formula C12H14N2O4S2 and a molecular weight of 314.4 g/mol. IUPAC name: (2-sulfamoyl-1,3-benzothiazol-6-yl) 2,2-dimethylpropanoate. InChIKey: FAZPZNCEAZRGPY-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (2-sulfamoyl-1,3-benzothiazol-6-yl) 2,2-dimethylpropanoate |
| InChIKey | FAZPZNCEAZRGPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC2=C(C=C1)N=C(S2)S(=O)(=O)N |
Computed by PubChem (NCBI)