CAS 400606-13-5 is the registry number for Fluorescein diacetate 6-maleimide. Offered by: Chemat. Available pack sizes: 25mg.
[6'-acetyloxy-6-(2,5-dioxopyrrol-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate (CAS 400606-13-5) is a chemical compound with the molecular formula C28H17NO9 and a molecular weight of 511.4 g/mol. IUPAC name: [6'-acetyloxy-6-(2,5-dioxopyrrol-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate. InChIKey: MIADUGLPTVXSRT-UHFFFAOYSA-N.
| Molecular formula | C28H17NO9 |
|---|---|
| Molecular weight | 511.4 g/mol |
| IUPAC name | [6'-acetyloxy-6-(2,5-dioxopyrrol-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| InChIKey | MIADUGLPTVXSRT-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=C(C=CC(=C5)N6C(=O)C=CC6=O)C(=O)O3 |
Computed by PubChem (NCBI)