Products 400755-56-8
CAS 400755-56-8 appears in our catalog under these names: 2-Chloro-n-(2,5-dimethylphenyl)propanamide, 95%, 2-Chloro-N-(2,5-dimethylphenyl)propanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 5000mg.
2-chloro-N-(2,5-dimethylphenyl)propanamide (CAS 400755-56-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 2-chloro-N-(2,5-dimethylphenyl)propanamide. InChIKey: XFJQOYYSGXWMEA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 2-chloro-N-(2,5-dimethylphenyl)propanamide |
| InChIKey | XFJQOYYSGXWMEA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)