CAS 400878-21-9 is the registry number for 3-Methoxy-3-oxoprop-1-en-1-yl 4-(trifluoromethyl)benzoate, 95% mix TBC as stabilizer. Offered by: AmBeed. Available pack sizes: 5g.
[(E)-3-methoxy-3-oxoprop-1-enyl] 4-(trifluoromethyl)benzoate (CAS 400878-21-9) is a chemical compound with the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. IUPAC name: [(E)-3-methoxy-3-oxoprop-1-enyl] 4-(trifluoromethyl)benzoate. InChIKey: PCVMIBKJGDEZEK-VOTSOKGWSA-N.
| Molecular formula | C12H9F3O4 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | [(E)-3-methoxy-3-oxoprop-1-enyl] 4-(trifluoromethyl)benzoate |
| InChIKey | PCVMIBKJGDEZEK-VOTSOKGWSA-N |
| SMILES | COC(=O)/C=C/OC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)