CAS 400899-99-2 appears in our catalog under these names: Trans-(4-hydroxy-cyclohexyl)-methyl-carbamic acid tert-butyl ester, 95%, trans–(4–hydroxy–cyclohexyl)–methyl–carbamic acid tert–butyl ester, Trans-(4-hydroxy-cyclohexyl)-methyl-carbamic Acid tert-Butyl Ester, trans-4-[Boc(methyl)amino]cyclohexanol 97%, tert-Butyl (trans-4-Hydroxycyclohexyl)(methyl)carbamate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
Tert-butyl N-(4-hydroxycyclohexyl)-N-methylcarbamate (CAS 400899-99-2) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl N-(4-hydroxycyclohexyl)-N-methylcarbamate. InChIKey: UJHKURDWYJBHPD-UHFFFAOYSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl N-(4-hydroxycyclohexyl)-N-methylcarbamate |
| InChIKey | UJHKURDWYJBHPD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1CCC(CC1)O |
Computed by PubChem (NCBI)