Products 40143-27-9
CAS 40143-27-9 appears in our catalog under these names: 4-Phenylbenzaldehyde oxime, 4-Phenylbenzaldehyde oxime, min. 95 %, 5 g, 4-Phenylbenzaldehyde oxime, min. 95 %, 10 g, 4-Phenylbenzaldehyde oxime, min. 95 %, 25 g, (E)-[1,1'-biphenyl]-4-carbaldehyde oxime, 98%. Offered by: Biosynth, Roth, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 25g, 1g.
(NE)-N-[(4-phenylphenyl)methylidene]hydroxylamine (CAS 40143-27-9) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (NE)-N-[(4-phenylphenyl)methylidene]hydroxylamine. InChIKey: OUNAWNXTMKAPFT-GXDHUFHOSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (NE)-N-[(4-phenylphenyl)methylidene]hydroxylamine |
| InChIKey | OUNAWNXTMKAPFT-GXDHUFHOSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=N/O |
Computed by PubChem (NCBI)