CAS 40146-54-1 is the registry number for 1-Amino-3-(ethoxycarbonyl)pyridin-1-ium 2,4,6-trimethylbenzenesulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 1-aminopyridin-1-ium-3-carboxylate;2,4,6-trimethylbenzenesulfonate (CAS 40146-54-1) is a chemical compound with the molecular formula C17H22N2O5S and a molecular weight of 366.4 g/mol. IUPAC name: ethyl 1-aminopyridin-1-ium-3-carboxylate;2,4,6-trimethylbenzenesulfonate. InChIKey: OJTFVTQMKWFWNQ-UHFFFAOYSA-M.
| Molecular formula | C17H22N2O5S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | ethyl 1-aminopyridin-1-ium-3-carboxylate;2,4,6-trimethylbenzenesulfonate |
| InChIKey | OJTFVTQMKWFWNQ-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=C[N+](=CC=C1)N.CC1=CC(=C(C(=C1)C)S(=O)(=O)[O-])C |
Computed by PubChem (NCBI)