CAS 934495-38-2 is the registry number for (S)-ethyl 4-(1-hydrazinylethyl)benzoate benzenesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Benzenesulfonic acid;ethyl 4-(1-hydrazinylethyl)benzoate (CAS 934495-38-2) is a chemical compound with the molecular formula C17H22N2O5S and a molecular weight of 366.4 g/mol. IUPAC name: benzenesulfonic acid;ethyl 4-(1-hydrazinylethyl)benzoate. InChIKey: RKELBFSJSQMTLO-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O5S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | benzenesulfonic acid;ethyl 4-(1-hydrazinylethyl)benzoate |
| InChIKey | RKELBFSJSQMTLO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(C)NN.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)