CAS 40154-84-5 appears in our catalog under these names: (S)-1-(Pyridin-3-yl)ethanamine dihydrochloride, 95%, (S)–1–(Pyridin–3–yl)ethanamine dihydrochloride, (S)-1-Pyridin-3-yl-ethylamine 2HCl, 3-Pyridinemethanamine, α-methyl-, dihydrochloride, (S)-, 95%, 95%, (S)-1-PYRIDIN-3-YL-ETHYLAMINE DIHYDROCHLORIDE, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g.
(1S)-1-pyridin-3-ylethanamine;dihydrochloride (CAS 40154-84-5) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1S)-1-pyridin-3-ylethanamine;dihydrochloride. InChIKey: FSDMOCFYBMVHLU-ILKKLZGPSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1S)-1-pyridin-3-ylethanamine;dihydrochloride |
| InChIKey | FSDMOCFYBMVHLU-ILKKLZGPSA-N |
| SMILES | C[C@@H](C1=CN=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)