Products 401813-08-9
CAS 401813-08-9 is the registry number for 1,4-Anhydro-3-O-[bis(4-methoxyphenyl)phenylmethyl]-2-deoxy-D-erythro-pentitol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(2R,3S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methanol (CAS 401813-08-9) is a chemical compound with the molecular formula C26H28O5 and a molecular weight of 420.5 g/mol. IUPAC name: [(2R,3S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methanol. InChIKey: OKBZQNKCADFXEE-LOSJGSFVSA-N.
| Molecular formula | C26H28O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | [(2R,3S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methanol |
| InChIKey | OKBZQNKCADFXEE-LOSJGSFVSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)O[C@H]4CCO[C@@H]4CO |
Computed by PubChem (NCBI)