CAS 40188-34-9 is the registry number for N-[(2,4,6-Trimethylphenyl)methylidene]hydroxylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[(2,4,6-trimethylphenyl)methylidene]hydroxylamine (CAS 40188-34-9) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (NE)-N-[(2,4,6-trimethylphenyl)methylidene]hydroxylamine. InChIKey: QYZKLTLEVQDKFJ-IZZDOVSWSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (NE)-N-[(2,4,6-trimethylphenyl)methylidene]hydroxylamine |
| InChIKey | QYZKLTLEVQDKFJ-IZZDOVSWSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)/C=N/O)C |
Computed by PubChem (NCBI)