Products 4019-63-0
CAS 4019-63-0 appears in our catalog under these names: Anisole-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, ANISOLE-METHYL-D3, 99 ATOM % D. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 1g.
Trideuteriomethoxybenzene (CAS 4019-63-0) is a chemical compound with the molecular formula C7H8O and a molecular weight of 111.16 g/mol. IUPAC name: trideuteriomethoxybenzene. InChIKey: RDOXTESZEPMUJZ-FIBGUPNXSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 111.16 g/mol |
| IUPAC name | trideuteriomethoxybenzene |
| InChIKey | RDOXTESZEPMUJZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1 |
Computed by PubChem (NCBI)