CAS 54887-54-6 appears in our catalog under these names: Anisole-d8, >95% (GC), Anisole-d8, 98 atom % D, min 98% Chemical Purity, ANISOLE-D8, 98 ATOM % D. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 0,5g.
1,2,3,4,5-pentadeuterio-6-(trideuteriomethoxy)benzene (CAS 54887-54-6) is a chemical compound with the molecular formula C7H8O and a molecular weight of 116.19 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethoxy)benzene. InChIKey: RDOXTESZEPMUJZ-JGUCLWPXSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 116.19 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethoxy)benzene |
| InChIKey | RDOXTESZEPMUJZ-JGUCLWPXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)